C17H12ClNO — CID 132600230
4-(4-chlorophenyl)-2,3-dihydrofuro[2,3-b]quinoline (PubChem CID 132600230) has the molecular formula C17H12ClNO and a molecular weight of 281.74 g/mol. Its IUPAC name is 4-(4-chlorophenyl)-2,3-dihydrofuro[2,3-b]quinoline.
| Compound Name | 4-(4-chlorophenyl)-2,3-dihydrofuro[2,3-b]quinoline |
|---|---|
| PubChem CID | 132600230 |
| Molecular Formula | C17H12ClNO |
| Molecular Weight | 281.74 g/mol |
| Exact Mass | 281.06 |
| IUPAC Name | 4-(4-chlorophenyl)-2,3-dihydrofuro[2,3-b]quinoline |
| SMILES | Clc1ccc(-c2c3c(nc4ccccc24)OCC3)cc1 |
| InChI | InChI=1S/C17H12ClNO/c18-12-7-5-11(6-8-12)16-13-3-1-2-4-15(13)19-17-14(16)9-10-20-17/h1-8H,9-10H2 |
| InChIKey | WROAHPZQEUXUOI-UHFFFAOYSA-N |
| XLogP | 4.49 |
| TPSA | 22.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.74 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |