C20H16O — CID 154231459
4,5-diphenyl-2,3-dihydro-1-benzofuran (PubChem CID 154231459) has the molecular formula C20H16O and a molecular weight of 272.35 g/mol. Its IUPAC name is 4,5-diphenyl-2,3-dihydro-1-benzofuran.
| Compound Name | 4,5-diphenyl-2,3-dihydro-1-benzofuran |
|---|---|
| PubChem CID | 154231459 |
| Molecular Formula | C20H16O |
| Molecular Weight | 272.35 g/mol |
| Exact Mass | 272.12 |
| IUPAC Name | 4,5-diphenyl-2,3-dihydro-1-benzofuran |
| SMILES | c1ccc(-c2ccc3c(c2-c2ccccc2)CCO3)cc1 |
| InChI | InChI=1S/C20H16O/c1-3-7-15(8-4-1)17-11-12-19-18(13-14-21-19)20(17)16-9-5-2-6-10-16/h1-12H,13-14H2 |
| InChIKey | OCLGXNNBALJQLE-UHFFFAOYSA-N |
| XLogP | 4.96 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.35 |
| LogP ≤ 5 | 4.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |