C14H11ClO — CID 12878337
5-chloro-6-phenyl-2,3-dihydro-1-benzofuran (PubChem CID 12878337) has the molecular formula C14H11ClO and a molecular weight of 230.69 g/mol. Its IUPAC name is 5-chloro-6-phenyl-2,3-dihydro-1-benzofuran.
| Compound Name | 5-chloro-6-phenyl-2,3-dihydro-1-benzofuran |
|---|---|
| PubChem CID | 12878337 |
| Molecular Formula | C14H11ClO |
| Molecular Weight | 230.69 g/mol |
| Exact Mass | 230.05 |
| IUPAC Name | 5-chloro-6-phenyl-2,3-dihydro-1-benzofuran |
| SMILES | Clc1cc2c(cc1-c1ccccc1)OCC2 |
| InChI | InChI=1S/C14H11ClO/c15-13-8-11-6-7-16-14(11)9-12(13)10-4-2-1-3-5-10/h1-5,8-9H,6-7H2 |
| InChIKey | HKLHUMUOWXLIBE-UHFFFAOYSA-N |
| XLogP | 3.94 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.69 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |