About 1,2-dihydrobenzo[e][1]benzofuran;hydrate
1,2-dihydrobenzo[e][1]benzofuran;hydrate (PubChem CID 118007569) has the molecular formula C12H12O2
and a molecular weight of 188.23 g/mol. Its IUPAC name is 1,2-dihydrobenzo[e][1]benzofuran;hydrate.
Molecular Properties
| Compound Name | 1,2-dihydrobenzo[e][1]benzofuran;hydrate |
| PubChem CID | 118007569 |
| Molecular Formula | C12H12O2 |
| Molecular Weight | 188.23 g/mol |
| Exact Mass | 188.08 |
| IUPAC Name | 1,2-dihydrobenzo[e][1]benzofuran;hydrate |
| SMILES | O.c1ccc2c3c(ccc2c1)OCC3 |
| InChI | InChI=1S/C12H10O.H2O/c1-2-4-10-9(3-1)5-6-12-11(10)7-8-13-12;/h1-6H,7-8H2;1H2 |
| InChIKey | ZHRNEDXSBJXXQM-UHFFFAOYSA-N |
| XLogP | 1.95 |
| TPSA | 40.73 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 188.23 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 1,2-dihydrobenzo[e][1]benzofuran;hydrate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,2-dihydrobenzo[e][1]benzofuran;hydrate?
The IUPAC name of 1,2-dihydrobenzo[e][1]benzofuran;hydrate (CID 118007569) is 1,2-dihydrobenzo[e][1]benzofuran;hydrate.
What is the SMILES notation for 1,2-dihydrobenzo[e][1]benzofuran;hydrate?
The canonical SMILES for 1,2-dihydrobenzo[e][1]benzofuran;hydrate is O.c1ccc2c3c(ccc2c1)OCC3.
What is the InChIKey of 1,2-dihydrobenzo[e][1]benzofuran;hydrate?
The InChIKey is ZHRNEDXSBJXXQM-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H10O.H2O/c1-2-4-10-9(3-1)5-6-12-11(10)7-8-13-12;/h1-6H,7-8H2;1H2.
What are the key properties of 1,2-dihydrobenzo[e][1]benzofuran;hydrate?
1,2-dihydrobenzo[e][1]benzofuran;hydrate has a molecular weight of 188.23 g/mol, XLogP of 1.95, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1,2-dihydrobenzo[e][1]benzofuran;hydrate is sourced from PubChem (CID 118007569), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).