C29H20N4 — CID 163388235
2,6-diphenyl-8-(2-phenylphenyl)-7H-purine (PubChem CID 163388235) has the molecular formula C29H20N4 and a molecular weight of 424.51 g/mol. Its IUPAC name is 2,6-diphenyl-8-(2-phenylphenyl)-7H-purine.
| Compound Name | 2,6-diphenyl-8-(2-phenylphenyl)-7H-purine |
|---|---|
| PubChem CID | 163388235 |
| Molecular Formula | C29H20N4 |
| Molecular Weight | 424.51 g/mol |
| Exact Mass | 424.17 |
| IUPAC Name | 2,6-diphenyl-8-(2-phenylphenyl)-7H-purine |
| SMILES | c1ccc(-c2nc(-c3ccccc3)c3[nH]c(-c4ccccc4-c4ccccc4)nc3n2)cc1 |
| InChI | InChI=1S/C29H20N4/c1-4-12-20(13-5-1)23-18-10-11-19-24(23)28-31-26-25(21-14-6-2-7-15-21)30-27(32-29(26)33-28)22-16-8-3-9-17-22/h1-19H,(H,30,31,32,33) |
| InChIKey | OTKILXATBBWMOS-UHFFFAOYSA-N |
| XLogP | 7.02 |
| TPSA | 54.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.51 |
| LogP ≤ 5 | 7.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |