C11H11N3O — CID 135552035
6-ethyl-4-phenyl-1H-1,3,5-triazin-2-one (PubChem CID 135552035) has the molecular formula C11H11N3O and a molecular weight of 201.23 g/mol. Its IUPAC name is 6-ethyl-4-phenyl-1H-1,3,5-triazin-2-one.
| Compound Name | 6-ethyl-4-phenyl-1H-1,3,5-triazin-2-one |
|---|---|
| PubChem CID | 135552035 |
| Molecular Formula | C11H11N3O |
| Molecular Weight | 201.23 g/mol |
| Exact Mass | 201.09 |
| IUPAC Name | 6-ethyl-4-phenyl-1H-1,3,5-triazin-2-one |
| SMILES | CCc1nc(-c2ccccc2)nc(=O)[nH]1 |
| InChI | InChI=1S/C11H11N3O/c1-2-9-12-10(14-11(15)13-9)8-6-4-3-5-7-8/h3-7H,2H2,1H3,(H,12,13,14,15) |
| InChIKey | OEERUNRSSABHEA-UHFFFAOYSA-N |
| XLogP | 1.39 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 201.23 |
| LogP ≤ 5 | 1.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |