C15H17N3 — CID 114742459
4-ethyl-2-phenyl-5,6,7,8-tetrahydropyrido[3,4-d]pyrimidine (PubChem CID 114742459) has the molecular formula C15H17N3 and a molecular weight of 239.32 g/mol. Its IUPAC name is 4-ethyl-2-phenyl-5,6,7,8-tetrahydropyrido[3,4-d]pyrimidine.
| Compound Name | 4-ethyl-2-phenyl-5,6,7,8-tetrahydropyrido[3,4-d]pyrimidine |
|---|---|
| PubChem CID | 114742459 |
| Molecular Formula | C15H17N3 |
| Molecular Weight | 239.32 g/mol |
| Exact Mass | 239.14 |
| IUPAC Name | 4-ethyl-2-phenyl-5,6,7,8-tetrahydropyrido[3,4-d]pyrimidine |
| SMILES | CCc1nc(-c2ccccc2)nc2c1CCNC2 |
| InChI | InChI=1S/C15H17N3/c1-2-13-12-8-9-16-10-14(12)18-15(17-13)11-6-4-3-5-7-11/h3-7,16H,2,8-10H2,1H3 |
| InChIKey | VNKIGKWPHFJXGX-UHFFFAOYSA-N |
| XLogP | 2.35 |
| TPSA | 37.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.32 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |