C13H9N3O3 — CID 135463212
2-(4-methyl-6-oxo-1H-pyrimidin-2-yl)isoindole-1,3-dione (PubChem CID 135463212) has the molecular formula C13H9N3O3 and a molecular weight of 255.23 g/mol. Its IUPAC name is 2-(4-methyl-6-oxo-1H-pyrimidin-2-yl)isoindole-1,3-dione.
| Compound Name | 2-(4-methyl-6-oxo-1H-pyrimidin-2-yl)isoindole-1,3-dione |
|---|---|
| PubChem CID | 135463212 |
| Molecular Formula | C13H9N3O3 |
| Molecular Weight | 255.23 g/mol |
| Exact Mass | 255.06 |
| IUPAC Name | 2-(4-methyl-6-oxo-1H-pyrimidin-2-yl)isoindole-1,3-dione |
| SMILES | Cc1cc(=O)[nH]c(N2C(=O)c3ccccc3C2=O)n1 |
| InChI | InChI=1S/C13H9N3O3/c1-7-6-10(17)15-13(14-7)16-11(18)8-4-2-3-5-9(8)12(16)19/h2-6H,1H3,(H,14,15,17) |
| InChIKey | RGUNMHIQWJLZMO-UHFFFAOYSA-N |
| XLogP | 0.88 |
| TPSA | 83.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.23 |
| LogP ≤ 5 | 0.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|