C10H5O5RbS — CID 139842307
3,4-dioxonaphthalene-1-sulfonate;rubidium(1+) (PubChem CID 139842307) has the molecular formula C10H5O5RbS and a molecular weight of 322.68 g/mol. Its IUPAC name is 3,4-dioxonaphthalene-1-sulfonate;rubidium(1+).
| Compound Name | 3,4-dioxonaphthalene-1-sulfonate;rubidium(1+) |
|---|---|
| PubChem CID | 139842307 |
| Molecular Formula | C10H5O5RbS |
| Molecular Weight | 322.68 g/mol |
| Exact Mass | 321.90 |
| IUPAC Name | 3,4-dioxonaphthalene-1-sulfonate;rubidium(1+) |
| SMILES | O=C1C=C(S(=O)(=O)[O-])c2ccccc2C1=O.[Rb+] |
| InChI | InChI=1S/C10H6O5S.Rb/c11-8-5-9(16(13,14)15)6-3-1-2-4-7(6)10(8)12;/h1-5H,(H,13,14,15);/q;+1/p-1 |
| InChIKey | YWKCYIYLHRDEBT-UHFFFAOYSA-M |
| XLogP | -2.66 |
| TPSA | 91.34 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.68 |
| LogP ≤ 5 | -2.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'quinone_D(2)', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|