C17H14O4 — CID 10107799
tricyclo[10.3.1.14,8]heptadeca-1(15),4,7,12-tetraene-6,14,16,17-tetrone (PubChem CID 10107799) has the molecular formula C17H14O4 and a molecular weight of 282.30 g/mol. Its IUPAC name is tricyclo[10.3.1.14,8]heptadeca-1(15),4,7,12-tetraene-6,14,16,17-tetrone.
| Compound Name | tricyclo[10.3.1.14,8]heptadeca-1(15),4,7,12-tetraene-6,14,16,17-tetrone |
|---|---|
| PubChem CID | 10107799 |
| Molecular Formula | C17H14O4 |
| Molecular Weight | 282.30 g/mol |
| Exact Mass | 282.09 |
| IUPAC Name | tricyclo[10.3.1.14,8]heptadeca-1(15),4,7,12-tetraene-6,14,16,17-tetrone |
| SMILES | O=C1C=C2CCCC3=CC(=O)C=C(CCC(=C1)C2=O)C3=O |
| InChI | InChI=1S/C17H14O4/c18-14-6-10-2-1-3-11-7-15(19)9-13(17(11)21)5-4-12(8-14)16(10)20/h6-9H,1-5H2 |
| InChIKey | VZHJGJXEGMOARB-UHFFFAOYSA-N |
| XLogP | 1.96 |
| TPSA | 68.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.30 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'chinone_1', 'substructure': 'N/A'} |
|---|