C20H20O4 — CID 15759179
tricyclo[13.3.1.14,8]icosa-1(18),4,7,15-tetraene-6,17,19,20-tetrone (PubChem CID 15759179) has the molecular formula C20H20O4 and a molecular weight of 324.38 g/mol. Its IUPAC name is tricyclo[13.3.1.14,8]icosa-1(18),4,7,15-tetraene-6,17,19,20-tetrone.
| Compound Name | tricyclo[13.3.1.14,8]icosa-1(18),4,7,15-tetraene-6,17,19,20-tetrone |
|---|---|
| PubChem CID | 15759179 |
| Molecular Formula | C20H20O4 |
| Molecular Weight | 324.38 g/mol |
| Exact Mass | 324.14 |
| IUPAC Name | tricyclo[13.3.1.14,8]icosa-1(18),4,7,15-tetraene-6,17,19,20-tetrone |
| SMILES | O=C1C=C2CCCCCCC3=CC(=O)C=C(CCC(=C1)C2=O)C3=O |
| InChI | InChI=1S/C20H20O4/c21-17-9-13-5-3-1-2-4-6-14-10-18(22)12-16(20(14)24)8-7-15(11-17)19(13)23/h9-12H,1-8H2 |
| InChIKey | XLMJXAICIJKGJK-UHFFFAOYSA-N |
| XLogP | 3.13 |
| TPSA | 68.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.38 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'chinone_1', 'substructure': 'N/A'} |
|---|