C18H21NO2 — CID 102185156
19-azatricyclo[12.3.1.16,9]nonadeca-1(17),6,8,14-tetraene-16,18-dione (PubChem CID 102185156) has the molecular formula C18H21NO2 and a molecular weight of 283.37 g/mol. Its IUPAC name is 19-azatricyclo[12.3.1.16,9]nonadeca-1(17),6,8,14-tetraene-16,18-dione.
| Compound Name | 19-azatricyclo[12.3.1.16,9]nonadeca-1(17),6,8,14-tetraene-16,18-dione |
|---|---|
| PubChem CID | 102185156 |
| Molecular Formula | C18H21NO2 |
| Molecular Weight | 283.37 g/mol |
| Exact Mass | 283.16 |
| IUPAC Name | 19-azatricyclo[12.3.1.16,9]nonadeca-1(17),6,8,14-tetraene-16,18-dione |
| SMILES | O=C1C=C2CCCCc3ccc([nH]3)CCCCC(=C1)C2=O |
| InChI | InChI=1S/C18H21NO2/c20-17-11-13-5-1-3-7-15-9-10-16(19-15)8-4-2-6-14(12-17)18(13)21/h9-12,19H,1-8H2 |
| InChIKey | OEULMRHPFBXBMI-UHFFFAOYSA-N |
| XLogP | 3.46 |
| TPSA | 49.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.37 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'chinone_1', 'substructure': 'N/A'} |
|---|