C8H8ClNO — CID 12813897
7-chloro-1,4,5,6-tetrahydroindol-2-one (PubChem CID 12813897) has the molecular formula C8H8ClNO and a molecular weight of 169.61 g/mol. Its IUPAC name is 7-chloro-1,4,5,6-tetrahydroindol-2-one.
| Compound Name | 7-chloro-1,4,5,6-tetrahydroindol-2-one |
|---|---|
| PubChem CID | 12813897 |
| Molecular Formula | C8H8ClNO |
| Molecular Weight | 169.61 g/mol |
| Exact Mass | 169.03 |
| IUPAC Name | 7-chloro-1,4,5,6-tetrahydroindol-2-one |
| SMILES | O=C1C=C2CCCC(Cl)=C2N1 |
| InChI | InChI=1S/C8H8ClNO/c9-6-3-1-2-5-4-7(11)10-8(5)6/h4H,1-3H2,(H,10,11) |
| InChIKey | NZHBZEWXBWXAIH-UHFFFAOYSA-N |
| XLogP | 1.68 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 169.61 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |