C8H12Cl2 — CID 56634873
1,2-dichlorocyclooctene (PubChem CID 56634873) has the molecular formula C8H12Cl2 and a molecular weight of 179.09 g/mol. Its IUPAC name is 1,2-dichlorocyclooctene.
| Compound Name | 1,2-dichlorocyclooctene |
|---|---|
| PubChem CID | 56634873 |
| Molecular Formula | C8H12Cl2 |
| Molecular Weight | 179.09 g/mol |
| Exact Mass | 178.03 |
| IUPAC Name | 1,2-dichlorocyclooctene |
| SMILES | ClC1=C(Cl)CCCCCC1 |
| InChI | InChI=1S/C8H12Cl2/c9-7-5-3-1-2-4-6-8(7)10/h1-6H2 |
| InChIKey | GVEPDUWVJNRMFO-UHFFFAOYSA-N |
| XLogP | 4.03 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 179.09 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |