C23H22N2O3 — CID 15731727
2-(15,17-dimethoxy-18-oxo-7-tricyclo[11.3.1.15,9]octadeca-1(16),5,8,13(17),14-pentaenylidene)propanedinitrile (PubChem CID 15731727) has the molecular formula C23H22N2O3 and a molecular weight of 374.44 g/mol. Its IUPAC name is 2-(15,17-dimethoxy-18-oxo-7-tricyclo[11.3.1.15,9]octadeca-1(16),5,8,13(17),14-pentaenylidene)propanedinitrile.
| Compound Name | 2-(15,17-dimethoxy-18-oxo-7-tricyclo[11.3.1.15,9]octadeca-1(16),5,8,13(17),14-pentaenylidene)propanedinitrile |
|---|---|
| PubChem CID | 15731727 |
| Molecular Formula | C23H22N2O3 |
| Molecular Weight | 374.44 g/mol |
| Exact Mass | 374.16 |
| IUPAC Name | 2-(15,17-dimethoxy-18-oxo-7-tricyclo[11.3.1.15,9]octadeca-1(16),5,8,13(17),14-pentaenylidene)propanedinitrile |
| SMILES | COc1cc2c(OC)c(c1)CCCC1=CC(=C(C#N)C#N)C=C(CCC2)C1=O |
| InChI | InChI=1S/C23H22N2O3/c1-27-21-11-17-7-3-5-15-9-19(20(13-24)14-25)10-16(22(15)26)6-4-8-18(12-21)23(17)28-2/h9-12H,3-8H2,1-2H3 |
| InChIKey | GELYMICIIGGKIG-UHFFFAOYSA-N |
| XLogP | 4.14 |
| TPSA | 83.11 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.44 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|