C25H30O5 — CID 15249086
7-tert-butyl-15,17,18-trimethoxytricyclo[11.3.1.15,9]octadeca-1(16),5,7,9(18),13(17),14-hexaene-3,11-dione (PubChem CID 15249086) has the molecular formula C25H30O5 and a molecular weight of 410.51 g/mol. Its IUPAC name is 7-tert-butyl-15,17,18-trimethoxytricyclo[11.3.1.15,9]octadeca-1(16),5,7,9(18),13(17),14-hexaene-3,11-dione.
| Compound Name | 7-tert-butyl-15,17,18-trimethoxytricyclo[11.3.1.15,9]octadeca-1(16),5,7,9(18),13(17),14-hexaene-3,11-dione |
|---|---|
| PubChem CID | 15249086 |
| Molecular Formula | C25H30O5 |
| Molecular Weight | 410.51 g/mol |
| Exact Mass | 410.21 |
| IUPAC Name | 7-tert-butyl-15,17,18-trimethoxytricyclo[11.3.1.15,9]octadeca-1(16),5,7,9(18),13(17),14-hexaene-3,11-dione |
| SMILES | COc1cc2c(OC)c(c1)CC(=O)Cc1cc(C(C)(C)C)cc(c1OC)CC(=O)C2 |
| InChI | InChI=1S/C25H30O5/c1-25(2,3)19-7-15-9-20(26)11-17-13-22(28-4)14-18(24(17)30-6)12-21(27)10-16(8-19)23(15)29-5/h7-8,13-14H,9-12H2,1-6H3 |
| InChIKey | BICHVHSOWOVNLG-UHFFFAOYSA-N |
| XLogP | 4.03 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.51 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |