About 10,10-dimethyltricyclo[7.1.1.03,7]undeca-2,7-diene
10,10-dimethyltricyclo[7.1.1.03,7]undeca-2,7-diene (PubChem CID 91198196) has the molecular formula C13H18
and a molecular weight of 174.29 g/mol. Its IUPAC name is 10,10-dimethyltricyclo[7.1.1.03,7]undeca-2,7-diene.
Analyze 10,10-dimethyltricyclo[7.1.1.03,7]undeca-2,7-diene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 10,10-dimethyltricyclo[7.1.1.03,7]undeca-2,7-diene?
The IUPAC name of 10,10-dimethyltricyclo[7.1.1.03,7]undeca-2,7-diene (CID 91198196) is 10,10-dimethyltricyclo[7.1.1.03,7]undeca-2,7-diene.
What is the SMILES notation for 10,10-dimethyltricyclo[7.1.1.03,7]undeca-2,7-diene?
The canonical SMILES for 10,10-dimethyltricyclo[7.1.1.03,7]undeca-2,7-diene is CC1(C)C2C=C3CCCC3=CC1C2.
What is the InChIKey of 10,10-dimethyltricyclo[7.1.1.03,7]undeca-2,7-diene?
The InChIKey is XJUZKQRSIKQBDN-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H18/c1-13(2)11-6-9-4-3-5-10(9)7-12(13)8-11/h6-7,11-12H,3-5,8H2,1-2H3.
What are the key properties of 10,10-dimethyltricyclo[7.1.1.03,7]undeca-2,7-diene?
10,10-dimethyltricyclo[7.1.1.03,7]undeca-2,7-diene has a molecular weight of 174.29 g/mol, XLogP of 3.70, 0 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 10,10-dimethyltricyclo[7.1.1.03,7]undeca-2,7-diene is sourced from PubChem (CID 91198196), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).