C21H34B- — CID 173394328
methyl-bis(4,6,6-trimethyl-3-bicyclo[3.1.1]hept-2-enyl)boranuide (PubChem CID 173394328) has the molecular formula C21H34B- and a molecular weight of 297.31 g/mol. Its IUPAC name is methyl-bis(4,6,6-trimethyl-3-bicyclo[3.1.1]hept-2-enyl)boranuide.
| Compound Name | methyl-bis(4,6,6-trimethyl-3-bicyclo[3.1.1]hept-2-enyl)boranuide |
|---|---|
| PubChem CID | 173394328 |
| Molecular Formula | C21H34B- |
| Molecular Weight | 297.31 g/mol |
| Exact Mass | 297.28 |
| IUPAC Name | methyl-bis(4,6,6-trimethyl-3-bicyclo[3.1.1]hept-2-enyl)boranuide |
| SMILES | C[BH-](C1=CC2CC(C1C)C2(C)C)C1=CC2CC(C1C)C2(C)C |
| InChI | InChI=1S/C21H34B/c1-12-16-8-14(20(16,3)4)10-18(12)22(7)19-11-15-9-17(13(19)2)21(15,5)6/h10-17,22H,8-9H2,1-7H3/q-1 |
| InChIKey | KBZOLJHWJXHLQP-UHFFFAOYSA-N |
| XLogP | 5.40 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.31 |
| LogP ≤ 5 | 5.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|