C14H25B — CID 10867418
diethyl-[(1R,6S)-4,7,7-trimethyl-3-bicyclo[4.1.0]hept-4-enyl]borane (PubChem CID 10867418) has the molecular formula C14H25B and a molecular weight of 204.17 g/mol. Its IUPAC name is diethyl-[(1R,6S)-4,7,7-trimethyl-3-bicyclo[4.1.0]hept-4-enyl]borane.
| Compound Name | diethyl-[(1R,6S)-4,7,7-trimethyl-3-bicyclo[4.1.0]hept-4-enyl]borane |
|---|---|
| PubChem CID | 10867418 |
| Molecular Formula | C14H25B |
| Molecular Weight | 204.17 g/mol |
| Exact Mass | 204.20 |
| IUPAC Name | diethyl-[(1R,6S)-4,7,7-trimethyl-3-bicyclo[4.1.0]hept-4-enyl]borane |
| SMILES | CCB(CC)C1C[C@@H]2[C@H](C=C1C)C2(C)C |
| InChI | InChI=1S/C14H25B/c1-6-15(7-2)13-9-12-11(8-10(13)3)14(12,4)5/h8,11-13H,6-7,9H2,1-5H3/t11-,12+,13?/m0/s1 |
| InChIKey | OYIAUINSRKMKMN-LAGVYOHYSA-N |
| XLogP | 4.51 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 204.17 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|