C10H16O — CID 98049886
[(1R,6R)-7,7-dimethyl-3-bicyclo[4.1.0]hept-2-enyl]methanol (PubChem CID 98049886) has the molecular formula C10H16O and a molecular weight of 152.24 g/mol. Its IUPAC name is [(1R,6R)-7,7-dimethyl-3-bicyclo[4.1.0]hept-2-enyl]methanol.
| Compound Name | [(1R,6R)-7,7-dimethyl-3-bicyclo[4.1.0]hept-2-enyl]methanol |
|---|---|
| PubChem CID | 98049886 |
| Molecular Formula | C10H16O |
| Molecular Weight | 152.24 g/mol |
| Exact Mass | 152.12 |
| IUPAC Name | [(1R,6R)-7,7-dimethyl-3-bicyclo[4.1.0]hept-2-enyl]methanol |
| SMILES | CC1(C)[C@@H]2C=C(CO)CC[C@H]21 |
| InChI | InChI=1S/C10H16O/c1-10(2)8-4-3-7(6-11)5-9(8)10/h5,8-9,11H,3-4,6H2,1-2H3/t8-,9-/m1/s1 |
| InChIKey | NATPOHWVZBGQEV-RKDXNWHRSA-N |
| XLogP | 1.97 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 152.24 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|