C13H16Cl2 — CID 177403430
(1R,6S)-3-[(1Z)-4,4-dichlorobuta-1,3-dienyl]-7,7-dimethylbicyclo[4.1.0]hept-2-ene (PubChem CID 177403430) has the molecular formula C13H16Cl2 and a molecular weight of 243.18 g/mol. Its IUPAC name is (1R,6S)-3-[(1Z)-4,4-dichlorobuta-1,3-dienyl]-7,7-dimethylbicyclo[4.1.0]hept-2-ene.
| Compound Name | (1R,6S)-3-[(1Z)-4,4-dichlorobuta-1,3-dienyl]-7,7-dimethylbicyclo[4.1.0]hept-2-ene |
|---|---|
| PubChem CID | 177403430 |
| Molecular Formula | C13H16Cl2 |
| Molecular Weight | 243.18 g/mol |
| Exact Mass | 242.06 |
| IUPAC Name | (1R,6S)-3-[(1Z)-4,4-dichlorobuta-1,3-dienyl]-7,7-dimethylbicyclo[4.1.0]hept-2-ene |
| SMILES | CC1(C)[C@@H]2C=C(/C=C\C=C(Cl)Cl)CC[C@@H]21 |
| InChI | InChI=1S/C13H16Cl2/c1-13(2)10-7-6-9(8-11(10)13)4-3-5-12(14)15/h3-5,8,10-11H,6-7H2,1-2H3/b4-3-/t10-,11+/m0/s1 |
| InChIKey | WUVBPFQUBCJYRJ-CBZSPVTBSA-N |
| XLogP | 4.85 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.18 |
| LogP ≤ 5 | 4.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|