C12H19OP — CID 597604
5,9,9-trimethyl-5lambda5-phosphatricyclo[6.1.1.02,6]dec-6-ene 5-oxide (PubChem CID 597604) has the molecular formula C12H19OP and a molecular weight of 210.26 g/mol. Its IUPAC name is 5,9,9-trimethyl-5lambda5-phosphatricyclo[6.1.1.02,6]dec-6-ene 5-oxide.
| Compound Name | 5,9,9-trimethyl-5lambda5-phosphatricyclo[6.1.1.02,6]dec-6-ene 5-oxide |
|---|---|
| PubChem CID | 597604 |
| Molecular Formula | C12H19OP |
| Molecular Weight | 210.26 g/mol |
| Exact Mass | 210.12 |
| IUPAC Name | 5,9,9-trimethyl-5lambda5-phosphatricyclo[6.1.1.02,6]dec-6-ene 5-oxide |
| SMILES | CC1(C)C2C=C3C(CCP3(C)=O)C1C2 |
| InChI | InChI=1S/C12H19OP/c1-12(2)8-6-10(12)9-4-5-14(3,13)11(9)7-8/h7-10H,4-6H2,1-3H3 |
| InChIKey | GCZMIXQUCFLJAU-UHFFFAOYSA-N |
| XLogP | 3.56 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 210.26 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|