C23H35N2+ — CID 22661628
1,3-bis(4,6,6-trimethyl-3-bicyclo[3.1.1]hept-2-enyl)-4,5-dihydroimidazol-1-ium (PubChem CID 22661628) has the molecular formula C23H35N2+ and a molecular weight of 339.55 g/mol. Its IUPAC name is 1,3-bis(4,6,6-trimethyl-3-bicyclo[3.1.1]hept-2-enyl)-4,5-dihydroimidazol-1-ium.
| Compound Name | 1,3-bis(4,6,6-trimethyl-3-bicyclo[3.1.1]hept-2-enyl)-4,5-dihydroimidazol-1-ium |
|---|---|
| PubChem CID | 22661628 |
| Molecular Formula | C23H35N2+ |
| Molecular Weight | 339.55 g/mol |
| Exact Mass | 339.28 |
| IUPAC Name | 1,3-bis(4,6,6-trimethyl-3-bicyclo[3.1.1]hept-2-enyl)-4,5-dihydroimidazol-1-ium |
| SMILES | CC1C(N2C=[N+](C3=CC4CC(C3C)C4(C)C)CC2)=CC2CC1C2(C)C |
| InChI | InChI=1S/C23H35N2/c1-14-18-9-16(22(18,3)4)11-20(14)24-7-8-25(13-24)21-12-17-10-19(15(21)2)23(17,5)6/h11-19H,7-10H2,1-6H3/q+1 |
| InChIKey | IZVDDSOHJMSZDY-UHFFFAOYSA-N |
| XLogP | 4.73 |
| TPSA | 6.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.55 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|