About oxido-(2,6,6-trimethyl-3-bicyclo[3.1.1]heptanylidene)oxidanium
oxido-(2,6,6-trimethyl-3-bicyclo[3.1.1]heptanylidene)oxidanium (PubChem CID 141322643) has the molecular formula C10H16O2
and a molecular weight of 168.24 g/mol. Its IUPAC name is oxido-(2,6,6-trimethyl-3-bicyclo[3.1.1]heptanylidene)oxidanium.
Molecular Properties
| Compound Name | oxido-(2,6,6-trimethyl-3-bicyclo[3.1.1]heptanylidene)oxidanium |
| PubChem CID | 141322643 |
| Molecular Formula | C10H16O2 |
| Molecular Weight | 168.24 g/mol |
| Exact Mass | 168.12 |
| IUPAC Name | oxido-(2,6,6-trimethyl-3-bicyclo[3.1.1]heptanylidene)oxidanium |
| SMILES | CC1/C(=[O+]/[O-])CC2CC1C2(C)C |
| InChI | InChI=1S/C10H16O2/c1-6-8-4-7(10(8,2)3)5-9(6)12-11/h6-8H,4-5H2,1-3H3 |
| InChIKey | ADRUNPYLHQDEQC-UHFFFAOYSA-N |
| XLogP | 1.07 |
| TPSA | 34.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 168.24 |
| LogP ≤ 5 | 1.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|
Analyze oxido-(2,6,6-trimethyl-3-bicyclo[3.1.1]heptanylidene)oxidanium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of oxido-(2,6,6-trimethyl-3-bicyclo[3.1.1]heptanylidene)oxidanium?
The IUPAC name of oxido-(2,6,6-trimethyl-3-bicyclo[3.1.1]heptanylidene)oxidanium (CID 141322643) is oxido-(2,6,6-trimethyl-3-bicyclo[3.1.1]heptanylidene)oxidanium.
What is the SMILES notation for oxido-(2,6,6-trimethyl-3-bicyclo[3.1.1]heptanylidene)oxidanium?
The canonical SMILES for oxido-(2,6,6-trimethyl-3-bicyclo[3.1.1]heptanylidene)oxidanium is CC1/C(=[O+]/[O-])CC2CC1C2(C)C.
What is the InChIKey of oxido-(2,6,6-trimethyl-3-bicyclo[3.1.1]heptanylidene)oxidanium?
The InChIKey is ADRUNPYLHQDEQC-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H16O2/c1-6-8-4-7(10(8,2)3)5-9(6)12-11/h6-8H,4-5H2,1-3H3.
What are the key properties of oxido-(2,6,6-trimethyl-3-bicyclo[3.1.1]heptanylidene)oxidanium?
oxido-(2,6,6-trimethyl-3-bicyclo[3.1.1]heptanylidene)oxidanium has a molecular weight of 168.24 g/mol, XLogP of 1.07, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for oxido-(2,6,6-trimethyl-3-bicyclo[3.1.1]heptanylidene)oxidanium is sourced from PubChem (CID 141322643), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).