About (5S)-6,6-dimethyl-3-methylidenebicyclo[3.1.1]heptane
(5S)-6,6-dimethyl-3-methylidenebicyclo[3.1.1]heptane (PubChem CID 173165956) has the molecular formula C10H16
and a molecular weight of 136.24 g/mol. Its IUPAC name is (5S)-6,6-dimethyl-3-methylidenebicyclo[3.1.1]heptane.
Molecular Properties
| Compound Name | (5S)-6,6-dimethyl-3-methylidenebicyclo[3.1.1]heptane |
| PubChem CID | 173165956 |
| Molecular Formula | C10H16 |
| Molecular Weight | 136.24 g/mol |
| Exact Mass | 136.13 |
| IUPAC Name | (5S)-6,6-dimethyl-3-methylidenebicyclo[3.1.1]heptane |
| SMILES | C=C1CC2C[C@@H](C1)C2(C)C |
| InChI | InChI=1S/C10H16/c1-7-4-8-6-9(5-7)10(8,2)3/h8-9H,1,4-6H2,2-3H3/t8-,9?/m1/s1 |
| InChIKey | AKTVSHXUPUGPRY-VEDVMXKPSA-N |
| XLogP | 3.00 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 136.24 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze (5S)-6,6-dimethyl-3-methylidenebicyclo[3.1.1]heptane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (5S)-6,6-dimethyl-3-methylidenebicyclo[3.1.1]heptane?
The IUPAC name of (5S)-6,6-dimethyl-3-methylidenebicyclo[3.1.1]heptane (CID 173165956) is (5S)-6,6-dimethyl-3-methylidenebicyclo[3.1.1]heptane.
What is the SMILES notation for (5S)-6,6-dimethyl-3-methylidenebicyclo[3.1.1]heptane?
The canonical SMILES for (5S)-6,6-dimethyl-3-methylidenebicyclo[3.1.1]heptane is C=C1CC2C[C@@H](C1)C2(C)C.
What is the InChIKey of (5S)-6,6-dimethyl-3-methylidenebicyclo[3.1.1]heptane?
The InChIKey is AKTVSHXUPUGPRY-VEDVMXKPSA-N. The full InChI is InChI=1S/C10H16/c1-7-4-8-6-9(5-7)10(8,2)3/h8-9H,1,4-6H2,2-3H3/t8-,9?/m1/s1.
What are the key properties of (5S)-6,6-dimethyl-3-methylidenebicyclo[3.1.1]heptane?
(5S)-6,6-dimethyl-3-methylidenebicyclo[3.1.1]heptane has a molecular weight of 136.24 g/mol, XLogP of 3.00, 0 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for (5S)-6,6-dimethyl-3-methylidenebicyclo[3.1.1]heptane is sourced from PubChem (CID 173165956), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).