C10H15+ — CID 134861256
CID 134861256 (PubChem CID 134861256) has the molecular formula C10H15+ and a molecular weight of 135.23 g/mol.
| Compound Name | CID 134861256 |
|---|---|
| PubChem CID | 134861256 |
| Molecular Formula | C10H15+ |
| Molecular Weight | 135.23 g/mol |
| Exact Mass | 135.12 |
| IUPAC Name | — |
| SMILES | C=C1[CH+]C[C@@H]2C[C@H]1C2(C)C |
| InChI | InChI=1S/C10H15/c1-7-4-5-8-6-9(7)10(8,2)3/h4,8-9H,1,5-6H2,2-3H3/q+1/t8-,9-/m1/s1 |
| InChIKey | QWUYMUZGMWSUCO-RKDXNWHRSA-N |
| XLogP | 2.81 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 135.23 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|