C12H16Cl3NO — CID 10732733
2,2,2-trichloro-N-[(1R,3S,5R)-6,6-dimethyl-2-methylidene-3-bicyclo[3.1.1]heptanyl]acetamide (PubChem CID 10732733) has the molecular formula C12H16Cl3NO and a molecular weight of 296.63 g/mol. Its IUPAC name is 2,2,2-trichloro-N-[(1R,3S,5R)-6,6-dimethyl-2-methylidene-3-bicyclo[3.1.1]heptanyl]acetamide.
| Compound Name | 2,2,2-trichloro-N-[(1R,3S,5R)-6,6-dimethyl-2-methylidene-3-bicyclo[3.1.1]heptanyl]acetamide |
|---|---|
| PubChem CID | 10732733 |
| Molecular Formula | C12H16Cl3NO |
| Molecular Weight | 296.63 g/mol |
| Exact Mass | 295.03 |
| IUPAC Name | 2,2,2-trichloro-N-[(1R,3S,5R)-6,6-dimethyl-2-methylidene-3-bicyclo[3.1.1]heptanyl]acetamide |
| SMILES | C=C1[C@@H](NC(=O)C(Cl)(Cl)Cl)C[C@H]2C[C@@H]1C2(C)C |
| InChI | InChI=1S/C12H16Cl3NO/c1-6-8-4-7(11(8,2)3)5-9(6)16-10(17)12(13,14)15/h7-9H,1,4-5H2,2-3H3,(H,16,17)/t7-,8+,9+/m1/s1 |
| InChIKey | YJPWMPVCJHDKHD-VGMNWLOBSA-N |
| XLogP | 3.46 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.63 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|