C19H26N2O2 — CID 167991166
(2S)-2-amino-N-[(1R,5R)-6,6-dimethyl-2-methylidene-3-bicyclo[3.1.1]heptanyl]-3-(4-hydroxyphenyl)propanamide (PubChem CID 167991166) has the molecular formula C19H26N2O2 and a molecular weight of 314.43 g/mol. Its IUPAC name is (2S)-2-amino-N-[(1R,5R)-6,6-dimethyl-2-methylidene-3-bicyclo[3.1.1]heptanyl]-3-(4-hydroxyphenyl)propanamide.
| Compound Name | (2S)-2-amino-N-[(1R,5R)-6,6-dimethyl-2-methylidene-3-bicyclo[3.1.1]heptanyl]-3-(4-hydroxyphenyl)propanamide |
|---|---|
| PubChem CID | 167991166 |
| Molecular Formula | C19H26N2O2 |
| Molecular Weight | 314.43 g/mol |
| Exact Mass | 314.20 |
| IUPAC Name | (2S)-2-amino-N-[(1R,5R)-6,6-dimethyl-2-methylidene-3-bicyclo[3.1.1]heptanyl]-3-(4-hydroxyphenyl)propanamide |
| SMILES | C=C1C(NC(=O)[C@@H](N)Cc2ccc(O)cc2)C[C@H]2C[C@@H]1C2(C)C |
| InChI | InChI=1S/C19H26N2O2/c1-11-15-9-13(19(15,2)3)10-17(11)21-18(23)16(20)8-12-4-6-14(22)7-5-12/h4-7,13,15-17,22H,1,8-10,20H2,2-3H3,(H,21,23)/t13-,15+,16+,17?/m1/s1 |
| InChIKey | YGEIHERWPYZIIE-XEFHEYMASA-N |
| XLogP | 2.37 |
| TPSA | 75.35 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.43 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|