C12H19NO2 — CID 18782852
(6,6-dimethyl-2-methylidene-3-bicyclo[3.1.1]heptanyl)methylcarbamic acid (PubChem CID 18782852) has the molecular formula C12H19NO2 and a molecular weight of 209.29 g/mol. Its IUPAC name is (6,6-dimethyl-2-methylidene-3-bicyclo[3.1.1]heptanyl)methylcarbamic acid.
| Compound Name | (6,6-dimethyl-2-methylidene-3-bicyclo[3.1.1]heptanyl)methylcarbamic acid |
|---|---|
| PubChem CID | 18782852 |
| Molecular Formula | C12H19NO2 |
| Molecular Weight | 209.29 g/mol |
| Exact Mass | 209.14 |
| IUPAC Name | (6,6-dimethyl-2-methylidene-3-bicyclo[3.1.1]heptanyl)methylcarbamic acid |
| SMILES | C=C1C(CNC(=O)O)CC2CC1C2(C)C |
| InChI | InChI=1S/C12H19NO2/c1-7-8(6-13-11(14)15)4-9-5-10(7)12(9,2)3/h8-10,13H,1,4-6H2,2-3H3,(H,14,15) |
| InChIKey | QOHVTCHOQMUNMJ-UHFFFAOYSA-N |
| XLogP | 2.49 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 209.29 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|