C13H20N2O2 — CID 6224370
[(E)-(6,6-dimethyl-2-methylidene-3-bicyclo[3.1.1]heptanylidene)amino] N-ethylcarbamate (PubChem CID 6224370) has the molecular formula C13H20N2O2 and a molecular weight of 236.31 g/mol. Its IUPAC name is [(E)-(6,6-dimethyl-2-methylidene-3-bicyclo[3.1.1]heptanylidene)amino] N-ethylcarbamate.
| Compound Name | [(E)-(6,6-dimethyl-2-methylidene-3-bicyclo[3.1.1]heptanylidene)amino] N-ethylcarbamate |
|---|---|
| PubChem CID | 6224370 |
| Molecular Formula | C13H20N2O2 |
| Molecular Weight | 236.31 g/mol |
| Exact Mass | 236.15 |
| IUPAC Name | [(E)-(6,6-dimethyl-2-methylidene-3-bicyclo[3.1.1]heptanylidene)amino] N-ethylcarbamate |
| SMILES | C=C1/C(=N/OC(=O)NCC)CC2CC1C2(C)C |
| InChI | InChI=1S/C13H20N2O2/c1-5-14-12(16)17-15-11-7-9-6-10(8(11)2)13(9,3)4/h9-10H,2,5-7H2,1,3-4H3,(H,14,16)/b15-11+ |
| InChIKey | COEJNDMPKBRNOQ-RVDMUPIBSA-N |
| XLogP | 2.71 |
| TPSA | 50.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.31 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|