C25H39N3O4 — CID 99574131
[(3R,8R,9S,10R,13S,14S,17Z)-17-(ethylcarbamoyloxyimino)-10,13-dimethyl-1,2,3,4,7,8,9,11,12,14,15,16-dodecahydrocyclopenta[a]phenanthren-3-yl] N-ethylcarbamate (PubChem CID 99574131) has the molecular formula C25H39N3O4 and a molecular weight of 445.60 g/mol. Its IUPAC name is [(3R,8R,9S,10R,13S,14S,17Z)-17-(ethylcarbamoyloxyimino)-10,13-dimethyl-1,2,3,4,7,8,9,11,12,14,15,16-dodecahydrocyclopenta[a]phenanthren-3-yl] N-ethylcarbamate.
| Compound Name | [(3R,8R,9S,10R,13S,14S,17Z)-17-(ethylcarbamoyloxyimino)-10,13-dimethyl-1,2,3,4,7,8,9,11,12,14,15,16-dodecahydrocyclopenta[a]phenanthren-3-yl] N-ethylcarbamate |
|---|---|
| PubChem CID | 99574131 |
| Molecular Formula | C25H39N3O4 |
| Molecular Weight | 445.60 g/mol |
| Exact Mass | 445.29 |
| IUPAC Name | [(3R,8R,9S,10R,13S,14S,17Z)-17-(ethylcarbamoyloxyimino)-10,13-dimethyl-1,2,3,4,7,8,9,11,12,14,15,16-dodecahydrocyclopenta[a]phenanthren-3-yl] N-ethylcarbamate |
| SMILES | CCNC(=O)O/N=C1/CC[C@H]2[C@@H]3CC=C4C[C@H](OC(=O)NCC)CC[C@]4(C)[C@H]3CC[C@]12C |
| InChI | InChI=1S/C25H39N3O4/c1-5-26-22(29)31-17-11-13-24(3)16(15-17)7-8-18-19-9-10-21(28-32-23(30)27-6-2)25(19,4)14-12-20(18)24/h7,17-20H,5-6,8-15H2,1-4H3,(H,26,29)(H,27,30)/b28-21-/t17-,18+,19+,20+,24+,25+/m1/s1 |
| InChIKey | SNAZURKPPNBWIB-XKEANTJWSA-N |
| XLogP | 5.17 |
| TPSA | 89.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.60 |
| LogP ≤ 5 | 5.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'oxime_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|