C24H37NO4 — CID 11661360
[(3R,10R,13S)-10,13-dimethyl-17-oxo-1,2,3,4,7,8,9,11,12,14,15,16-dodecahydrocyclopenta[a]phenanthren-3-yl] N-(2-ethoxyethyl)carbamate (PubChem CID 11661360) has the molecular formula C24H37NO4 and a molecular weight of 403.56 g/mol. Its IUPAC name is [(3R,10R,13S)-10,13-dimethyl-17-oxo-1,2,3,4,7,8,9,11,12,14,15,16-dodecahydrocyclopenta[a]phenanthren-3-yl] N-(2-ethoxyethyl)carbamate.
| Compound Name | [(3R,10R,13S)-10,13-dimethyl-17-oxo-1,2,3,4,7,8,9,11,12,14,15,16-dodecahydrocyclopenta[a]phenanthren-3-yl] N-(2-ethoxyethyl)carbamate |
|---|---|
| PubChem CID | 11661360 |
| Molecular Formula | C24H37NO4 |
| Molecular Weight | 403.56 g/mol |
| Exact Mass | 403.27 |
| IUPAC Name | [(3R,10R,13S)-10,13-dimethyl-17-oxo-1,2,3,4,7,8,9,11,12,14,15,16-dodecahydrocyclopenta[a]phenanthren-3-yl] N-(2-ethoxyethyl)carbamate |
| SMILES | CCOCCNC(=O)O[C@@H]1CC[C@@]2(C)C(=CCC3C2CC[C@]2(C)C(=O)CCC32)C1 |
| InChI | InChI=1S/C24H37NO4/c1-4-28-14-13-25-22(27)29-17-9-11-23(2)16(15-17)5-6-18-19-7-8-21(26)24(19,3)12-10-20(18)23/h5,17-20H,4,6-15H2,1-3H3,(H,25,27)/t17-,18?,19?,20?,23+,24+/m1/s1 |
| InChIKey | FKOJAKMJIGKXIB-PJXIQYHFSA-N |
| XLogP | 4.65 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.56 |
| LogP ≤ 5 | 4.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|