C15H24N2O2 — CID 29224666
tert-butyl N-[(Z)-[(1R,5S)-6,6-dimethyl-2-bicyclo[3.1.1]hept-2-enyl]methylideneamino]carbamate (PubChem CID 29224666) has the molecular formula C15H24N2O2 and a molecular weight of 264.37 g/mol. Its IUPAC name is tert-butyl N-[(Z)-[(1R,5S)-6,6-dimethyl-2-bicyclo[3.1.1]hept-2-enyl]methylideneamino]carbamate.
| Compound Name | tert-butyl N-[(Z)-[(1R,5S)-6,6-dimethyl-2-bicyclo[3.1.1]hept-2-enyl]methylideneamino]carbamate |
|---|---|
| PubChem CID | 29224666 |
| Molecular Formula | C15H24N2O2 |
| Molecular Weight | 264.37 g/mol |
| Exact Mass | 264.18 |
| IUPAC Name | tert-butyl N-[(Z)-[(1R,5S)-6,6-dimethyl-2-bicyclo[3.1.1]hept-2-enyl]methylideneamino]carbamate |
| SMILES | CC(C)(C)OC(=O)N/N=C\C1=CC[C@H]2C[C@@H]1C2(C)C |
| InChI | InChI=1S/C15H24N2O2/c1-14(2,3)19-13(18)17-16-9-10-6-7-11-8-12(10)15(11,4)5/h6,9,11-12H,7-8H2,1-5H3,(H,17,18)/b16-9-/t11-,12-/m0/s1 |
| InChIKey | HVHLNAGGFVPXFB-PVASGMGSSA-N |
| XLogP | 3.49 |
| TPSA | 50.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.37 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|