C17H20N4O3 — CID 129434613
3-amino-N-[[(1S,5S)-6,6-dimethyl-2-bicyclo[3.1.1]hept-2-enyl]methylideneamino]-5-nitrobenzamide (PubChem CID 129434613) has the molecular formula C17H20N4O3 and a molecular weight of 328.37 g/mol. Its IUPAC name is 3-amino-N-[[(1S,5S)-6,6-dimethyl-2-bicyclo[3.1.1]hept-2-enyl]methylideneamino]-5-nitrobenzamide.
| Compound Name | 3-amino-N-[[(1S,5S)-6,6-dimethyl-2-bicyclo[3.1.1]hept-2-enyl]methylideneamino]-5-nitrobenzamide |
|---|---|
| PubChem CID | 129434613 |
| Molecular Formula | C17H20N4O3 |
| Molecular Weight | 328.37 g/mol |
| Exact Mass | 328.15 |
| IUPAC Name | 3-amino-N-[[(1S,5S)-6,6-dimethyl-2-bicyclo[3.1.1]hept-2-enyl]methylideneamino]-5-nitrobenzamide |
| SMILES | CC1(C)[C@H]2CC=C(C=NNC(=O)c3cc(N)cc([N+](=O)[O-])c3)[C@H]1C2 |
| InChI | InChI=1S/C17H20N4O3/c1-17(2)12-4-3-10(15(17)7-12)9-19-20-16(22)11-5-13(18)8-14(6-11)21(23)24/h3,5-6,8-9,12,15H,4,7,18H2,1-2H3,(H,20,22)/t12-,15+/m0/s1 |
| InChIKey | KEYBWBUMGOQNDB-SWLSCSKDSA-N |
| XLogP | 2.88 |
| TPSA | 110.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.37 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|