C17H24N4O — CID 29355727
N-[(Z)-[(1S,5R)-6,6-dimethyl-2-bicyclo[3.1.1]hept-2-enyl]methylideneamino]-2-(3,5-dimethylpyrazol-1-yl)acetamide (PubChem CID 29355727) has the molecular formula C17H24N4O and a molecular weight of 300.41 g/mol. Its IUPAC name is N-[(Z)-[(1S,5R)-6,6-dimethyl-2-bicyclo[3.1.1]hept-2-enyl]methylideneamino]-2-(3,5-dimethylpyrazol-1-yl)acetamide.
| Compound Name | N-[(Z)-[(1S,5R)-6,6-dimethyl-2-bicyclo[3.1.1]hept-2-enyl]methylideneamino]-2-(3,5-dimethylpyrazol-1-yl)acetamide |
|---|---|
| PubChem CID | 29355727 |
| Molecular Formula | C17H24N4O |
| Molecular Weight | 300.41 g/mol |
| Exact Mass | 300.20 |
| IUPAC Name | N-[(Z)-[(1S,5R)-6,6-dimethyl-2-bicyclo[3.1.1]hept-2-enyl]methylideneamino]-2-(3,5-dimethylpyrazol-1-yl)acetamide |
| SMILES | Cc1cc(C)n(CC(=O)N/N=C\C2=CC[C@@H]3C[C@H]2C3(C)C)n1 |
| InChI | InChI=1S/C17H24N4O/c1-11-7-12(2)21(20-11)10-16(22)19-18-9-13-5-6-14-8-15(13)17(14,3)4/h5,7,9,14-15H,6,8,10H2,1-4H3,(H,19,22)/b18-9-/t14-,15-/m1/s1 |
| InChIKey | OSKZAFLEYURSLU-LKXCIRNOSA-N |
| XLogP | 2.59 |
| TPSA | 59.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.41 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|