C17H24N4O2 — CID 166279714
1-[(1R,5R)-6,6-dimethyl-2-methylidene-3-bicyclo[3.1.1]heptanyl]-3-[2-(6-oxopyridazin-1-yl)ethyl]urea (PubChem CID 166279714) has the molecular formula C17H24N4O2 and a molecular weight of 316.41 g/mol. Its IUPAC name is 1-[(1R,5R)-6,6-dimethyl-2-methylidene-3-bicyclo[3.1.1]heptanyl]-3-[2-(6-oxopyridazin-1-yl)ethyl]urea.
| Compound Name | 1-[(1R,5R)-6,6-dimethyl-2-methylidene-3-bicyclo[3.1.1]heptanyl]-3-[2-(6-oxopyridazin-1-yl)ethyl]urea |
|---|---|
| PubChem CID | 166279714 |
| Molecular Formula | C17H24N4O2 |
| Molecular Weight | 316.41 g/mol |
| Exact Mass | 316.19 |
| IUPAC Name | 1-[(1R,5R)-6,6-dimethyl-2-methylidene-3-bicyclo[3.1.1]heptanyl]-3-[2-(6-oxopyridazin-1-yl)ethyl]urea |
| SMILES | C=C1C(NC(=O)NCCn2ncccc2=O)C[C@H]2C[C@@H]1C2(C)C |
| InChI | InChI=1S/C17H24N4O2/c1-11-13-9-12(17(13,2)3)10-14(11)20-16(23)18-7-8-21-15(22)5-4-6-19-21/h4-6,12-14H,1,7-10H2,2-3H3,(H2,18,20,23)/t12-,13+,14?/m1/s1 |
| InChIKey | ZMDBXQFSZSNYFD-AMIUJLCOSA-N |
| XLogP | 1.53 |
| TPSA | 76.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.41 |
| LogP ≤ 5 | 1.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|