C14H14Cl2N4O2 — CID 30948649
1-(3,5-dichlorophenyl)-3-[3-(6-oxopyridazin-1-yl)propyl]urea (PubChem CID 30948649) has the molecular formula C14H14Cl2N4O2 and a molecular weight of 341.20 g/mol. Its IUPAC name is 1-(3,5-dichlorophenyl)-3-[3-(6-oxopyridazin-1-yl)propyl]urea.
| Compound Name | 1-(3,5-dichlorophenyl)-3-[3-(6-oxopyridazin-1-yl)propyl]urea |
|---|---|
| PubChem CID | 30948649 |
| Molecular Formula | C14H14Cl2N4O2 |
| Molecular Weight | 341.20 g/mol |
| Exact Mass | 340.05 |
| IUPAC Name | 1-(3,5-dichlorophenyl)-3-[3-(6-oxopyridazin-1-yl)propyl]urea |
| SMILES | O=C(NCCCn1ncccc1=O)Nc1cc(Cl)cc(Cl)c1 |
| InChI | InChI=1S/C14H14Cl2N4O2/c15-10-7-11(16)9-12(8-10)19-14(22)17-4-2-6-20-13(21)3-1-5-18-20/h1,3,5,7-9H,2,4,6H2,(H2,17,19,22) |
| InChIKey | NLEXJALQMGPDCX-UHFFFAOYSA-N |
| XLogP | 2.76 |
| TPSA | 76.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.20 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|