C19H27N2O2P — CID 166281234
1-[(1R,5R)-6,6-dimethyl-2-methylidene-3-bicyclo[3.1.1]heptanyl]-3-(4-dimethylphosphorylphenyl)urea (PubChem CID 166281234) has the molecular formula C19H27N2O2P and a molecular weight of 346.41 g/mol. Its IUPAC name is 1-[(1R,5R)-6,6-dimethyl-2-methylidene-3-bicyclo[3.1.1]heptanyl]-3-(4-dimethylphosphorylphenyl)urea.
| Compound Name | 1-[(1R,5R)-6,6-dimethyl-2-methylidene-3-bicyclo[3.1.1]heptanyl]-3-(4-dimethylphosphorylphenyl)urea |
|---|---|
| PubChem CID | 166281234 |
| Molecular Formula | C19H27N2O2P |
| Molecular Weight | 346.41 g/mol |
| Exact Mass | 346.18 |
| IUPAC Name | 1-[(1R,5R)-6,6-dimethyl-2-methylidene-3-bicyclo[3.1.1]heptanyl]-3-(4-dimethylphosphorylphenyl)urea |
| SMILES | C=C1C(NC(=O)Nc2ccc(P(C)(C)=O)cc2)C[C@H]2C[C@@H]1C2(C)C |
| InChI | InChI=1S/C19H27N2O2P/c1-12-16-10-13(19(16,2)3)11-17(12)21-18(22)20-14-6-8-15(9-7-14)24(4,5)23/h6-9,13,16-17H,1,10-11H2,2-5H3,(H2,20,21,22)/t13-,16+,17?/m1/s1 |
| InChIKey | DFHKZVORKWNQJI-WBTZKQGOSA-N |
| XLogP | 4.05 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.41 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|