C16H23BrN3O5P — CID 90399839
[(3S)-3-[(4-bromophenyl)carbamoylamino]-5-methyl-2-oxopyrrolidin-1-yl]methyl-propan-2-yloxyphosphinic acid (PubChem CID 90399839) has the molecular formula C16H23BrN3O5P and a molecular weight of 448.25 g/mol. Its IUPAC name is [(3S)-3-[(4-bromophenyl)carbamoylamino]-5-methyl-2-oxopyrrolidin-1-yl]methyl-propan-2-yloxyphosphinic acid.
| Compound Name | [(3S)-3-[(4-bromophenyl)carbamoylamino]-5-methyl-2-oxopyrrolidin-1-yl]methyl-propan-2-yloxyphosphinic acid |
|---|---|
| PubChem CID | 90399839 |
| Molecular Formula | C16H23BrN3O5P |
| Molecular Weight | 448.25 g/mol |
| Exact Mass | 447.06 |
| IUPAC Name | [(3S)-3-[(4-bromophenyl)carbamoylamino]-5-methyl-2-oxopyrrolidin-1-yl]methyl-propan-2-yloxyphosphinic acid |
| SMILES | CC(C)OP(=O)(O)CN1C(=O)[C@@H](NC(=O)Nc2ccc(Br)cc2)CC1C |
| InChI | InChI=1S/C16H23BrN3O5P/c1-10(2)25-26(23,24)9-20-11(3)8-14(15(20)21)19-16(22)18-13-6-4-12(17)5-7-13/h4-7,10-11,14H,8-9H2,1-3H3,(H,23,24)(H2,18,19,22)/t11?,14-/m0/s1 |
| InChIKey | FVEVZHJLJPMZMV-IAXJKZSUSA-N |
| XLogP | 3.13 |
| TPSA | 107.97 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.25 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|