C14H17N3O2 — CID 114631440
1-(4-cyanophenyl)-3-(3-hydroxy-2,2-dimethylcyclobutyl)urea (PubChem CID 114631440) has the molecular formula C14H17N3O2 and a molecular weight of 259.31 g/mol. Its IUPAC name is 1-(4-cyanophenyl)-3-(3-hydroxy-2,2-dimethylcyclobutyl)urea.
| Compound Name | 1-(4-cyanophenyl)-3-(3-hydroxy-2,2-dimethylcyclobutyl)urea |
|---|---|
| PubChem CID | 114631440 |
| Molecular Formula | C14H17N3O2 |
| Molecular Weight | 259.31 g/mol |
| Exact Mass | 259.13 |
| IUPAC Name | 1-(4-cyanophenyl)-3-(3-hydroxy-2,2-dimethylcyclobutyl)urea |
| SMILES | CC1(C)C(O)CC1NC(=O)Nc1ccc(C#N)cc1 |
| InChI | InChI=1S/C14H17N3O2/c1-14(2)11(7-12(14)18)17-13(19)16-10-5-3-9(8-15)4-6-10/h3-6,11-12,18H,7H2,1-2H3,(H2,16,17,19) |
| InChIKey | QUEBQBLHFOFIEC-UHFFFAOYSA-N |
| XLogP | 1.84 |
| TPSA | 85.15 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.31 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |