C16H20N4O — CID 95975783
1-(4-cyanophenyl)-3-[(3R,4R)-1-cyclopropyl-4-methylpyrrolidin-3-yl]urea (PubChem CID 95975783) has the molecular formula C16H20N4O and a molecular weight of 284.36 g/mol. Its IUPAC name is 1-(4-cyanophenyl)-3-[(3R,4R)-1-cyclopropyl-4-methylpyrrolidin-3-yl]urea.
| Compound Name | 1-(4-cyanophenyl)-3-[(3R,4R)-1-cyclopropyl-4-methylpyrrolidin-3-yl]urea |
|---|---|
| PubChem CID | 95975783 |
| Molecular Formula | C16H20N4O |
| Molecular Weight | 284.36 g/mol |
| Exact Mass | 284.16 |
| IUPAC Name | 1-(4-cyanophenyl)-3-[(3R,4R)-1-cyclopropyl-4-methylpyrrolidin-3-yl]urea |
| SMILES | C[C@@H]1CN(C2CC2)C[C@@H]1NC(=O)Nc1ccc(C#N)cc1 |
| InChI | InChI=1S/C16H20N4O/c1-11-9-20(14-6-7-14)10-15(11)19-16(21)18-13-4-2-12(8-17)3-5-13/h2-5,11,14-15H,6-7,9-10H2,1H3,(H2,18,19,21)/t11-,15+/m1/s1 |
| InChIKey | DCRROLHLQVPKFE-ABAIWWIYSA-N |
| XLogP | 2.16 |
| TPSA | 68.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.36 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |