C16H19N3O2 — CID 108519434
N-(4-cyanophenyl)-2-(2,6-dimethylpiperidin-1-yl)-2-oxoacetamide (PubChem CID 108519434) has the molecular formula C16H19N3O2 and a molecular weight of 285.35 g/mol. Its IUPAC name is N-(4-cyanophenyl)-2-(2,6-dimethylpiperidin-1-yl)-2-oxoacetamide.
| Compound Name | N-(4-cyanophenyl)-2-(2,6-dimethylpiperidin-1-yl)-2-oxoacetamide |
|---|---|
| PubChem CID | 108519434 |
| Molecular Formula | C16H19N3O2 |
| Molecular Weight | 285.35 g/mol |
| Exact Mass | 285.15 |
| IUPAC Name | N-(4-cyanophenyl)-2-(2,6-dimethylpiperidin-1-yl)-2-oxoacetamide |
| SMILES | CC1CCCC(C)N1C(=O)C(=O)Nc1ccc(C#N)cc1 |
| InChI | InChI=1S/C16H19N3O2/c1-11-4-3-5-12(2)19(11)16(21)15(20)18-14-8-6-13(10-17)7-9-14/h6-9,11-12H,3-5H2,1-2H3,(H,18,20) |
| InChIKey | OSCITBAUFWUTPV-UHFFFAOYSA-N |
| XLogP | 2.29 |
| TPSA | 73.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.35 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|