C16H20N4O — CID 97311576
1-[(7S,8aR)-1,2,3,5,6,7,8,8a-octahydroindolizin-7-yl]-3-(4-cyanophenyl)urea (PubChem CID 97311576) has the molecular formula C16H20N4O and a molecular weight of 284.36 g/mol. Its IUPAC name is 1-[(7S,8aR)-1,2,3,5,6,7,8,8a-octahydroindolizin-7-yl]-3-(4-cyanophenyl)urea.
| Compound Name | 1-[(7S,8aR)-1,2,3,5,6,7,8,8a-octahydroindolizin-7-yl]-3-(4-cyanophenyl)urea |
|---|---|
| PubChem CID | 97311576 |
| Molecular Formula | C16H20N4O |
| Molecular Weight | 284.36 g/mol |
| Exact Mass | 284.16 |
| IUPAC Name | 1-[(7S,8aR)-1,2,3,5,6,7,8,8a-octahydroindolizin-7-yl]-3-(4-cyanophenyl)urea |
| SMILES | N#Cc1ccc(NC(=O)N[C@H]2CCN3CCC[C@@H]3C2)cc1 |
| InChI | InChI=1S/C16H20N4O/c17-11-12-3-5-13(6-4-12)18-16(21)19-14-7-9-20-8-1-2-15(20)10-14/h3-6,14-15H,1-2,7-10H2,(H2,18,19,21)/t14-,15+/m0/s1 |
| InChIKey | YIRHHZSJHNXRFU-LSDHHAIUSA-N |
| XLogP | 2.31 |
| TPSA | 68.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.36 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |