C21H22N6O4 — CID 123809526
2-[(2-aminophenyl)carbamoyl]-4-[(4-cyanophenyl)carbamoylamino]piperidine-1-carboxylic acid (PubChem CID 123809526) has the molecular formula C21H22N6O4 and a molecular weight of 422.45 g/mol. Its IUPAC name is 2-[(2-aminophenyl)carbamoyl]-4-[(4-cyanophenyl)carbamoylamino]piperidine-1-carboxylic acid.
| Compound Name | 2-[(2-aminophenyl)carbamoyl]-4-[(4-cyanophenyl)carbamoylamino]piperidine-1-carboxylic acid |
|---|---|
| PubChem CID | 123809526 |
| Molecular Formula | C21H22N6O4 |
| Molecular Weight | 422.45 g/mol |
| Exact Mass | 422.17 |
| IUPAC Name | 2-[(2-aminophenyl)carbamoyl]-4-[(4-cyanophenyl)carbamoylamino]piperidine-1-carboxylic acid |
| SMILES | N#Cc1ccc(NC(=O)NC2CCN(C(=O)O)C(C(=O)Nc3ccccc3N)C2)cc1 |
| InChI | InChI=1S/C21H22N6O4/c22-12-13-5-7-14(8-6-13)24-20(29)25-15-9-10-27(21(30)31)18(11-15)19(28)26-17-4-2-1-3-16(17)23/h1-8,15,18H,9-11,23H2,(H,26,28)(H,30,31)(H2,24,25,29) |
| InChIKey | GOGYSFPMKTWGEV-UHFFFAOYSA-N |
| XLogP | 2.41 |
| TPSA | 160.58 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.45 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|