C12H12Cl3N3O2 — CID 4615513
1-(4-chlorophenyl)-3-[(2,2-dichloro-1-methylcyclopropanecarbonyl)amino]urea (PubChem CID 4615513) has the molecular formula C12H12Cl3N3O2 and a molecular weight of 336.61 g/mol. Its IUPAC name is 1-(4-chlorophenyl)-3-[(2,2-dichloro-1-methylcyclopropanecarbonyl)amino]urea.
| Compound Name | 1-(4-chlorophenyl)-3-[(2,2-dichloro-1-methylcyclopropanecarbonyl)amino]urea |
|---|---|
| PubChem CID | 4615513 |
| Molecular Formula | C12H12Cl3N3O2 |
| Molecular Weight | 336.61 g/mol |
| Exact Mass | 335.00 |
| IUPAC Name | 1-(4-chlorophenyl)-3-[(2,2-dichloro-1-methylcyclopropanecarbonyl)amino]urea |
| SMILES | CC1(C(=O)NNC(=O)Nc2ccc(Cl)cc2)CC1(Cl)Cl |
| InChI | InChI=1S/C12H12Cl3N3O2/c1-11(6-12(11,14)15)9(19)17-18-10(20)16-8-4-2-7(13)3-5-8/h2-5H,6H2,1H3,(H,17,19)(H2,16,18,20) |
| InChIKey | NLGKCIMXCCWZKC-UHFFFAOYSA-N |
| XLogP | 3.08 |
| TPSA | 70.23 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.61 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|