C11H9Cl4NO — CID 43004730
2,2-dichloro-N-(2,4-dichlorophenyl)-1-methylcyclopropane-1-carboxamide (PubChem CID 43004730) has the molecular formula C11H9Cl4NO and a molecular weight of 313.01 g/mol. Its IUPAC name is 2,2-dichloro-N-(2,4-dichlorophenyl)-1-methylcyclopropane-1-carboxamide.
| Compound Name | 2,2-dichloro-N-(2,4-dichlorophenyl)-1-methylcyclopropane-1-carboxamide |
|---|---|
| PubChem CID | 43004730 |
| Molecular Formula | C11H9Cl4NO |
| Molecular Weight | 313.01 g/mol |
| Exact Mass | 310.94 |
| IUPAC Name | 2,2-dichloro-N-(2,4-dichlorophenyl)-1-methylcyclopropane-1-carboxamide |
| SMILES | CC1(C(=O)Nc2ccc(Cl)cc2Cl)CC1(Cl)Cl |
| InChI | InChI=1S/C11H9Cl4NO/c1-10(5-11(10,14)15)9(17)16-8-3-2-6(12)4-7(8)13/h2-4H,5H2,1H3,(H,16,17) |
| InChIKey | ZEOSWLRBLURMFG-UHFFFAOYSA-N |
| XLogP | 4.52 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.01 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|