C17H19Cl2NO — CID 98086138
(1R,4S)-N-(2,4-dichlorophenyl)-3,3-dimethyl-2-methylidenebicyclo[2.2.1]heptane-1-carboxamide (PubChem CID 98086138) has the molecular formula C17H19Cl2NO and a molecular weight of 324.25 g/mol. Its IUPAC name is (1R,4S)-N-(2,4-dichlorophenyl)-3,3-dimethyl-2-methylidenebicyclo[2.2.1]heptane-1-carboxamide.
| Compound Name | (1R,4S)-N-(2,4-dichlorophenyl)-3,3-dimethyl-2-methylidenebicyclo[2.2.1]heptane-1-carboxamide |
|---|---|
| PubChem CID | 98086138 |
| Molecular Formula | C17H19Cl2NO |
| Molecular Weight | 324.25 g/mol |
| Exact Mass | 323.08 |
| IUPAC Name | (1R,4S)-N-(2,4-dichlorophenyl)-3,3-dimethyl-2-methylidenebicyclo[2.2.1]heptane-1-carboxamide |
| SMILES | C=C1C(C)(C)[C@H]2CC[C@@]1(C(=O)Nc1ccc(Cl)cc1Cl)C2 |
| InChI | InChI=1S/C17H19Cl2NO/c1-10-16(2,3)11-6-7-17(10,9-11)15(21)20-14-5-4-12(18)8-13(14)19/h4-5,8,11H,1,6-7,9H2,2-3H3,(H,20,21)/t11-,17+/m0/s1 |
| InChIKey | HUSJARBOKVIBMX-APPDUMDISA-N |
| XLogP | 5.31 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.25 |
| LogP ≤ 5 | 5.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|