C17H18Cl3NO — CID 4728586
3,3-dimethyl-2-methylidene-N-(2,4,5-trichlorophenyl)bicyclo[2.2.1]heptane-1-carboxamide (PubChem CID 4728586) has the molecular formula C17H18Cl3NO and a molecular weight of 358.70 g/mol. Its IUPAC name is 3,3-dimethyl-2-methylidene-N-(2,4,5-trichlorophenyl)bicyclo[2.2.1]heptane-1-carboxamide.
| Compound Name | 3,3-dimethyl-2-methylidene-N-(2,4,5-trichlorophenyl)bicyclo[2.2.1]heptane-1-carboxamide |
|---|---|
| PubChem CID | 4728586 |
| Molecular Formula | C17H18Cl3NO |
| Molecular Weight | 358.70 g/mol |
| Exact Mass | 357.05 |
| IUPAC Name | 3,3-dimethyl-2-methylidene-N-(2,4,5-trichlorophenyl)bicyclo[2.2.1]heptane-1-carboxamide |
| SMILES | C=C1C2(C(=O)Nc3cc(Cl)c(Cl)cc3Cl)CCC(C2)C1(C)C |
| InChI | InChI=1S/C17H18Cl3NO/c1-9-16(2,3)10-4-5-17(9,8-10)15(22)21-14-7-12(19)11(18)6-13(14)20/h6-7,10H,1,4-5,8H2,2-3H3,(H,21,22) |
| InChIKey | ZUENKRXUOOJMLR-UHFFFAOYSA-N |
| XLogP | 5.97 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.70 |
| LogP ≤ 5 | 5.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|