C11H12Cl2N2O2 — CID 64892685
3-amino-N-(2,4-dichlorophenyl)oxolane-3-carboxamide (PubChem CID 64892685) has the molecular formula C11H12Cl2N2O2 and a molecular weight of 275.13 g/mol. Its IUPAC name is 3-amino-N-(2,4-dichlorophenyl)oxolane-3-carboxamide.
| Compound Name | 3-amino-N-(2,4-dichlorophenyl)oxolane-3-carboxamide |
|---|---|
| PubChem CID | 64892685 |
| Molecular Formula | C11H12Cl2N2O2 |
| Molecular Weight | 275.13 g/mol |
| Exact Mass | 274.03 |
| IUPAC Name | 3-amino-N-(2,4-dichlorophenyl)oxolane-3-carboxamide |
| SMILES | NC1(C(=O)Nc2ccc(Cl)cc2Cl)CCOC1 |
| InChI | InChI=1S/C11H12Cl2N2O2/c12-7-1-2-9(8(13)5-7)15-10(16)11(14)3-4-17-6-11/h1-2,5H,3-4,6,14H2,(H,15,16) |
| InChIKey | XMASOSHBJPTOLP-UHFFFAOYSA-N |
| XLogP | 2.05 |
| TPSA | 64.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.13 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |