C14H19ClN2O4 — CID 115293932
4-amino-N-(2-chloro-4,5-dimethoxyphenyl)oxane-4-carboxamide (PubChem CID 115293932) has the molecular formula C14H19ClN2O4 and a molecular weight of 314.77 g/mol. Its IUPAC name is 4-amino-N-(2-chloro-4,5-dimethoxyphenyl)oxane-4-carboxamide.
| Compound Name | 4-amino-N-(2-chloro-4,5-dimethoxyphenyl)oxane-4-carboxamide |
|---|---|
| PubChem CID | 115293932 |
| Molecular Formula | C14H19ClN2O4 |
| Molecular Weight | 314.77 g/mol |
| Exact Mass | 314.10 |
| IUPAC Name | 4-amino-N-(2-chloro-4,5-dimethoxyphenyl)oxane-4-carboxamide |
| SMILES | COc1cc(Cl)c(NC(=O)C2(N)CCOCC2)cc1OC |
| InChI | InChI=1S/C14H19ClN2O4/c1-19-11-7-9(15)10(8-12(11)20-2)17-13(18)14(16)3-5-21-6-4-14/h7-8H,3-6,16H2,1-2H3,(H,17,18) |
| InChIKey | LOKWBGUUORQGML-UHFFFAOYSA-N |
| XLogP | 1.80 |
| TPSA | 82.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.77 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |